About (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol
(2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol (PubChem CID 67223858) has the molecular formula C6H6N4OS
and a molecular weight of 182.21 g/mol. Its IUPAC name is (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol.
Molecular Properties
| Compound Name | (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol |
| PubChem CID | 67223858 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol |
| SMILES | OCc1ncnc2nn(S)cc12 |
| InChI | InChI=1S/C6H6N4OS/c11-2-5-4-1-10(12)9-6(4)8-3-7-5/h1,3,11-12H,2H2 |
| InChIKey | NOCFZRCAMRGRLC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol?
The IUPAC name of (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol (CID 67223858) is (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol.
What is the SMILES notation for (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol?
The canonical SMILES for (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol is OCc1ncnc2nn(S)cc12.
What is the InChIKey of (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol?
The InChIKey is NOCFZRCAMRGRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4OS/c11-2-5-4-1-10(12)9-6(4)8-3-7-5/h1,3,11-12H,2H2.
What are the key properties of (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol?
(2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol has a molecular weight of 182.21 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-sulfanylpyrazolo[3,4-d]pyrimidin-4-yl)methanol is sourced from PubChem (CID 67223858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).