C16H21FN2O3 — CID 67223877
[4-[1-(4-fluorophenyl)ethylcarbamoyl]cyclohexyl]carbamic acid (PubChem CID 67223877) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is [4-[1-(4-fluorophenyl)ethylcarbamoyl]cyclohexyl]carbamic acid.
| Compound Name | [4-[1-(4-fluorophenyl)ethylcarbamoyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67223877 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [4-[1-(4-fluorophenyl)ethylcarbamoyl]cyclohexyl]carbamic acid |
| SMILES | CC(NC(=O)C1CCC(NC(=O)O)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O3/c1-10(11-2-6-13(17)7-3-11)18-15(20)12-4-8-14(9-5-12)19-16(21)22/h2-3,6-7,10,12,14,19H,4-5,8-9H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | IHICJKMSYFNJHP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |