About 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one
1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one (PubChem CID 67224028) has the molecular formula C23H21F3N2O2
and a molecular weight of 414.43 g/mol. Its IUPAC name is 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one |
| PubChem CID | 67224028 |
| Molecular Formula | C23H21F3N2O2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCN(C(=O)C=Cc3ccccc3C(F)(F)F)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H21F3N2O2/c1-27-19-9-5-4-8-18(19)22(21(27)30)12-14-28(15-13-22)20(29)11-10-16-6-2-3-7-17(16)23(24,25)26/h2-11H,12-15H2,1H3 |
| InChIKey | PBIATEATCXZUGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one?
The IUPAC name of 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one (CID 67224028) is 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one?
The canonical SMILES for 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one is CN1C(=O)C2(CCN(C(=O)C=Cc3ccccc3C(F)(F)F)CC2)c2ccccc21.
What is the InChIKey of 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one?
The InChIKey is PBIATEATCXZUGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F3N2O2/c1-27-19-9-5-4-8-18(19)22(21(27)30)12-14-28(15-13-22)20(29)11-10-16-6-2-3-7-17(16)23(24,25)26/h2-11H,12-15H2,1H3.
What are the key properties of 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one?
1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one has a molecular weight of 414.43 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 67224028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).