C19H23ClN2O5S — CID 67224052
N-[6-acetyl-2-chloro-3-(2,2-dimethoxyethoxy)phenyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 67224052) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is N-[6-acetyl-2-chloro-3-(2,2-dimethoxyethoxy)phenyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[6-acetyl-2-chloro-3-(2,2-dimethoxyethoxy)phenyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67224052 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[6-acetyl-2-chloro-3-(2,2-dimethoxyethoxy)phenyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | COC(COc1ccc(C(C)=O)c(NC(=O)c2csc(C(C)C)n2)c1Cl)OC |
| InChI | InChI=1S/C19H23ClN2O5S/c1-10(2)19-21-13(9-28-19)18(24)22-17-12(11(3)23)6-7-14(16(17)20)27-8-15(25-4)26-5/h6-7,9-10,15H,8H2,1-5H3,(H,22,24) |
| InChIKey | SFODEBFICOSBQN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|