About 6-(4-fluorophenyl)-1,2,4-triazin-3-amine
6-(4-fluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 67224067) has the molecular formula C9H7FN4
and a molecular weight of 190.18 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1,2,4-triazin-3-amine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-1,2,4-triazin-3-amine |
| PubChem CID | 67224067 |
| Molecular Formula | C9H7FN4 |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 6-(4-fluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Nc1ncc(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C9H7FN4/c10-7-3-1-6(2-4-7)8-5-12-9(11)14-13-8/h1-5H,(H2,11,12,14) |
| InChIKey | LBLLDDIKZGADLZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-fluorophenyl)-1,2,4-triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-1,2,4-triazin-3-amine?
The IUPAC name of 6-(4-fluorophenyl)-1,2,4-triazin-3-amine (CID 67224067) is 6-(4-fluorophenyl)-1,2,4-triazin-3-amine.
What is the SMILES notation for 6-(4-fluorophenyl)-1,2,4-triazin-3-amine?
The canonical SMILES for 6-(4-fluorophenyl)-1,2,4-triazin-3-amine is Nc1ncc(-c2ccc(F)cc2)nn1.
What is the InChIKey of 6-(4-fluorophenyl)-1,2,4-triazin-3-amine?
The InChIKey is LBLLDDIKZGADLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN4/c10-7-3-1-6(2-4-7)8-5-12-9(11)14-13-8/h1-5H,(H2,11,12,14).
What are the key properties of 6-(4-fluorophenyl)-1,2,4-triazin-3-amine?
6-(4-fluorophenyl)-1,2,4-triazin-3-amine has a molecular weight of 190.18 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-1,2,4-triazin-3-amine is sourced from PubChem (CID 67224067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).