About 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid
7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid (PubChem CID 67224324) has the molecular formula C14H14BrNO3
and a molecular weight of 324.17 g/mol. Its IUPAC name is 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid |
| PubChem CID | 67224324 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid |
| SMILES | O=C1CC2(CCN(C(=O)O)CC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C14H14BrNO3/c15-10-3-1-2-9-11(17)8-14(12(9)10)4-6-16(7-5-14)13(18)19/h1-3H,4-8H2,(H,18,19) |
| InChIKey | BALUAGRQNPWZKM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid?
The IUPAC name of 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid (CID 67224324) is 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid.
What is the SMILES notation for 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid?
The canonical SMILES for 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid is O=C1CC2(CCN(C(=O)O)CC2)c2c(Br)cccc21.
What is the InChIKey of 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid?
The InChIKey is BALUAGRQNPWZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO3/c15-10-3-1-2-9-11(17)8-14(12(9)10)4-6-16(7-5-14)13(18)19/h1-3H,4-8H2,(H,18,19).
What are the key properties of 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid?
7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid has a molecular weight of 324.17 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylic acid is sourced from PubChem (CID 67224324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).