C24H37NO — CID 67224784
(3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67224784) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67224784 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H]1C=C2C[C@@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(C4CCCN4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C24H37NO/c1-15-13-16-14-17(26)8-10-23(16,2)20-9-11-24(3)18(21-5-4-12-25-21)6-7-19(24)22(15)20/h6,13,15,17,19-22,25-26H,4-5,7-12,14H2,1-3H3/t15-,17-,19-,20-,21?,22-,23-,24+/m0/s1 |
| InChIKey | ADHHYJNQEJDWRU-PAAYBOLLSA-N |
| XLogP | 4.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|