C25H39NO — CID 67224883
(3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67224883) has the molecular formula C25H39NO and a molecular weight of 369.59 g/mol. Its IUPAC name is (3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67224883 |
| Molecular Formula | C25H39NO |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.30 |
| IUPAC Name | (3S,7R,8R,9S,10R,13S,14S)-7,10,13,16-tetramethyl-17-pyrrolidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(C2CCCN2)[C@@]2(C)CC[C@H]3[C@@H]([C@@H](C)C=C4C[C@@H](O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C25H39NO/c1-15-12-17-14-18(27)7-9-24(17,3)19-8-10-25(4)20(22(15)19)13-16(2)23(25)21-6-5-11-26-21/h12,15,18-22,26-27H,5-11,13-14H2,1-4H3/t15-,18-,19-,20-,21?,22+,24-,25-/m0/s1 |
| InChIKey | OUXNEHWFKFXHPU-FVGXFLRESA-N |
| XLogP | 5.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|