About 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea
3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea (PubChem CID 67225137) has the molecular formula C10H12BrFN2O
and a molecular weight of 275.12 g/mol. Its IUPAC name is 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea |
| PubChem CID | 67225137 |
| Molecular Formula | C10H12BrFN2O |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCc1ccc(Br)cc1F |
| InChI | InChI=1S/C10H12BrFN2O/c1-14(2)10(15)13-6-7-3-4-8(11)5-9(7)12/h3-5H,6H2,1-2H3,(H,13,15) |
| InChIKey | XSUDMIFCCOIRBR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea?
The IUPAC name of 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea (CID 67225137) is 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea?
The canonical SMILES for 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea is CN(C)C(=O)NCc1ccc(Br)cc1F.
What is the InChIKey of 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea?
The InChIKey is XSUDMIFCCOIRBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrFN2O/c1-14(2)10(15)13-6-7-3-4-8(11)5-9(7)12/h3-5H,6H2,1-2H3,(H,13,15).
What are the key properties of 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea?
3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea has a molecular weight of 275.12 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-2-fluorophenyl)methyl]-1,1-dimethylurea is sourced from PubChem (CID 67225137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).