C11H13Cl2NO — CID 67225206
2-chloro-4-(4-chlorophenyl)-2-methylbutanamide (PubChem CID 67225206) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-chloro-4-(4-chlorophenyl)-2-methylbutanamide.
| Compound Name | 2-chloro-4-(4-chlorophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 67225206 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-chloro-4-(4-chlorophenyl)-2-methylbutanamide |
| SMILES | CC(Cl)(CCc1ccc(Cl)cc1)C(N)=O |
| InChI | InChI=1S/C11H13Cl2NO/c1-11(13,10(14)15)7-6-8-2-4-9(12)5-3-8/h2-5H,6-7H2,1H3,(H2,14,15) |
| InChIKey | DHOLEBYWQDCLDF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|