C25H36N2O — CID 67225349
1,1-bis(2,3,4-triethylphenyl)urea (PubChem CID 67225349) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 1,1-bis(2,3,4-triethylphenyl)urea.
| Compound Name | 1,1-bis(2,3,4-triethylphenyl)urea |
|---|---|
| PubChem CID | 67225349 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1,1-bis(2,3,4-triethylphenyl)urea |
| SMILES | CCc1ccc(N(C(N)=O)c2ccc(CC)c(CC)c2CC)c(CC)c1CC |
| InChI | InChI=1S/C25H36N2O/c1-7-17-13-15-23(21(11-5)19(17)9-3)27(25(26)28)24-16-14-18(8-2)20(10-4)22(24)12-6/h13-16H,7-12H2,1-6H3,(H2,26,28) |
| InChIKey | PHGYVMCINRNLOA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |