About methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate
methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate (PubChem CID 67225439) has the molecular formula C20H19F2N3O3
and a molecular weight of 387.39 g/mol. Its IUPAC name is methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate.
Molecular Properties
| Compound Name | methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate |
| PubChem CID | 67225439 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate |
| SMILES | COC(=O)c1ccc(N2CCNCC2)cc1Oc1cc2cc[nH]c2c(F)c1F |
| InChI | InChI=1S/C20H19F2N3O3/c1-27-20(26)14-3-2-13(25-8-6-23-7-9-25)11-15(14)28-16-10-12-4-5-24-19(12)18(22)17(16)21/h2-5,10-11,23-24H,6-9H2,1H3 |
| InChIKey | XLNLMGFSPMLTDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate?
The IUPAC name of methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate (CID 67225439) is methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate.
What is the SMILES notation for methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate?
The canonical SMILES for methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate is COC(=O)c1ccc(N2CCNCC2)cc1Oc1cc2cc[nH]c2c(F)c1F.
What is the InChIKey of methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate?
The InChIKey is XLNLMGFSPMLTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2N3O3/c1-27-20(26)14-3-2-13(25-8-6-23-7-9-25)11-15(14)28-16-10-12-4-5-24-19(12)18(22)17(16)21/h2-5,10-11,23-24H,6-9H2,1H3.
What are the key properties of methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate?
methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate has a molecular weight of 387.39 g/mol, XLogP of 3.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6,7-difluoro-1H-indol-5-yl)oxy]-4-piperazin-1-ylbenzoate is sourced from PubChem (CID 67225439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).