C24H37NO2 — CID 67225558
(8R,9R,10R,13S,14S)-10,13-dimethyl-17-piperidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 67225558) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-17-piperidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-17-piperidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 67225558 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-17-piperidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@]12CCC(O)CC1=CC(O)[C@@H]1[C@H]2CC[C@]2(C)C(C3CCCCN3)=CC[C@@H]12 |
| InChI | InChI=1S/C24H37NO2/c1-23-10-8-16(26)13-15(23)14-21(27)22-18-7-6-17(20-5-3-4-12-25-20)24(18,2)11-9-19(22)23/h6,14,16,18-22,25-27H,3-5,7-13H2,1-2H3/t16?,18-,19+,20?,21?,22-,23-,24+/m0/s1 |
| InChIKey | WYMDEKOKEFBHEB-BFAZIPLCSA-N |
| XLogP | 3.96 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|