C26H39NO — CID 67226099
(7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67226099) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67226099 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-piperidin-1-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@@H]1C=C2CC(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(N4CCCCC4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H39NO/c1-4-18-16-19-17-20(28)10-12-25(19,2)22-11-13-26(3)21(24(18)22)8-9-23(26)27-14-6-5-7-15-27/h9,16,18,21-22,24H,4-8,10-15,17H2,1-3H3/t18-,21+,22+,24+,25+,26+/m1/s1 |
| InChIKey | QLOJEIXUINXBLG-WVSGMKLRSA-N |
| XLogP | 6.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|