C26H35NO — CID 67226166
(8R,9R,10S,13S,14S)-7-ethyl-10,13-dimethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67226166) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-7-ethyl-10,13-dimethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-7-ethyl-10,13-dimethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67226166 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (8R,9R,10S,13S,14S)-7-ethyl-10,13-dimethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC1CC2CC(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(c4cccnc4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H35NO/c1-4-17-14-19-15-20(28)9-11-25(19,2)23-10-12-26(3)21(7-8-22(26)24(17)23)18-6-5-13-27-16-18/h5-7,13,16-17,19,22-24H,4,8-12,14-15H2,1-3H3/t17?,19?,22-,23+,24-,25-,26+/m0/s1 |
| InChIKey | UJFGNFRSXIJIKH-VMYVSZRISA-N |
| XLogP | 6.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |