C25H32N2O — CID 67226238
(7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-pyrimidin-4-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67226238) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-pyrimidin-4-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-pyrimidin-4-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67226238 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S)-7-ethyl-10,13-dimethyl-17-pyrimidin-4-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@@H]1C=C2CC(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)C(c4ccncn4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H32N2O/c1-4-16-13-17-14-18(28)7-10-24(17,2)21-8-11-25(3)19(5-6-20(25)23(16)21)22-9-12-26-15-27-22/h5,9,12-13,15-16,20-21,23H,4,6-8,10-11,14H2,1-3H3/t16-,20+,21+,23+,24+,25-/m1/s1 |
| InChIKey | PJCCVRNPWIKZDH-ZDQKIZLVSA-N |
| XLogP | 5.64 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|