C52H49ClN4O4 — CID 67227111
methyl 4-[4-[[4-(4-chlorophenyl)-6,6-dimethyl-2,5-dihydropyran-3-yl]methyl]piperazin-1-yl]-2-(1-tritylindazol-4-yl)oxybenzoate (PubChem CID 67227111) has the molecular formula C52H49ClN4O4 and a molecular weight of 829.44 g/mol. Its IUPAC name is methyl 4-[4-[[4-(4-chlorophenyl)-6,6-dimethyl-2,5-dihydropyran-3-yl]methyl]piperazin-1-yl]-2-(1-tritylindazol-4-yl)oxybenzoate.
| Compound Name | methyl 4-[4-[[4-(4-chlorophenyl)-6,6-dimethyl-2,5-dihydropyran-3-yl]methyl]piperazin-1-yl]-2-(1-tritylindazol-4-yl)oxybenzoate |
|---|---|
| PubChem CID | 67227111 |
| Molecular Formula | C52H49ClN4O4 |
| Molecular Weight | 829.44 g/mol |
| Exact Mass | 828.34 |
| IUPAC Name | methyl 4-[4-[[4-(4-chlorophenyl)-6,6-dimethyl-2,5-dihydropyran-3-yl]methyl]piperazin-1-yl]-2-(1-tritylindazol-4-yl)oxybenzoate |
| SMILES | COC(=O)c1ccc(N2CCN(CC3=C(c4ccc(Cl)cc4)CC(C)(C)OC3)CC2)cc1Oc1cccc2c1cnn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C52H49ClN4O4/c1-51(2)33-45(37-22-24-42(53)25-23-37)38(36-60-51)35-55-28-30-56(31-29-55)43-26-27-44(50(58)59-3)49(32-43)61-48-21-13-20-47-46(48)34-54-57(47)52(39-14-7-4-8-15-39,40-16-9-5-10-17-40)41-18-11-6-12-19-41/h4-27,32,34H,28-31,33,35-36H2,1-3H3 |
| InChIKey | NFAYWQLMHGDYRO-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.44 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|