C32H32Cl2F2N2O3 — CID 67227225
2-(2-chloro-3,5-difluorophenoxy)-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid (PubChem CID 67227225) has the molecular formula C32H32Cl2F2N2O3 and a molecular weight of 601.52 g/mol. Its IUPAC name is 2-(2-chloro-3,5-difluorophenoxy)-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-(2-chloro-3,5-difluorophenoxy)-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 67227225 |
| Molecular Formula | C32H32Cl2F2N2O3 |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 2-(2-chloro-3,5-difluorophenoxy)-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]benzoic acid |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)O)c(Oc4cc(F)cc(F)c4Cl)c3)CC2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C32H32Cl2F2N2O3/c1-32(2)10-9-21(26(18-32)20-3-5-22(33)6-4-20)19-37-11-13-38(14-12-37)24-7-8-25(31(39)40)28(17-24)41-29-16-23(35)15-27(36)30(29)34/h3-8,15-17H,9-14,18-19H2,1-2H3,(H,39,40) |
| InChIKey | NDPOQVUVKDNWBK-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|