About methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate
methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate (PubChem CID 67228257) has the molecular formula C23H28FN3O7
and a molecular weight of 477.49 g/mol. Its IUPAC name is methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate |
| PubChem CID | 67228257 |
| Molecular Formula | C23H28FN3O7 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)cc1Oc1cc(NC(=O)OC(C)(C)C)nc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H28FN3O7/c1-22(2,3)33-20(29)26-17-11-14(12-18(25-17)27-21(30)34-23(4,5)6)32-16-10-13(24)8-9-15(16)19(28)31-7/h8-12H,1-7H3,(H2,25,26,27,29,30) |
| InChIKey | ZUPJJWKZHYUUBQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate?
The IUPAC name of methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate (CID 67228257) is methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate.
What is the SMILES notation for methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate?
The canonical SMILES for methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate is COC(=O)c1ccc(F)cc1Oc1cc(NC(=O)OC(C)(C)C)nc(NC(=O)OC(C)(C)C)c1.
What is the InChIKey of methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate?
The InChIKey is ZUPJJWKZHYUUBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28FN3O7/c1-22(2,3)33-20(29)26-17-11-14(12-18(25-17)27-21(30)34-23(4,5)6)32-16-10-13(24)8-9-15(16)19(28)31-7/h8-12H,1-7H3,(H2,25,26,27,29,30).
What are the key properties of methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate?
methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate has a molecular weight of 477.49 g/mol, XLogP of 5.49, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]oxy]-4-fluorobenzoate is sourced from PubChem (CID 67228257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).