About 7-fluoro-1H-indol-5-ol
7-fluoro-1H-indol-5-ol (PubChem CID 67228331) has the molecular formula C8H6FNO
and a molecular weight of 151.14 g/mol. Its IUPAC name is 7-fluoro-1H-indol-5-ol.
Molecular Properties
| Compound Name | 7-fluoro-1H-indol-5-ol |
| PubChem CID | 67228331 |
| Molecular Formula | C8H6FNO |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 7-fluoro-1H-indol-5-ol |
| SMILES | Oc1cc(F)c2[nH]ccc2c1 |
| InChI | InChI=1S/C8H6FNO/c9-7-4-6(11)3-5-1-2-10-8(5)7/h1-4,10-11H |
| InChIKey | BHPNRPCMQYNLOO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1H-indol-5-ol?
The IUPAC name of 7-fluoro-1H-indol-5-ol (CID 67228331) is 7-fluoro-1H-indol-5-ol.
What is the SMILES notation for 7-fluoro-1H-indol-5-ol?
The canonical SMILES for 7-fluoro-1H-indol-5-ol is Oc1cc(F)c2[nH]ccc2c1.
What is the InChIKey of 7-fluoro-1H-indol-5-ol?
The InChIKey is BHPNRPCMQYNLOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO/c9-7-4-6(11)3-5-1-2-10-8(5)7/h1-4,10-11H.
What are the key properties of 7-fluoro-1H-indol-5-ol?
7-fluoro-1H-indol-5-ol has a molecular weight of 151.14 g/mol, XLogP of 2.01, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1H-indol-5-ol is sourced from PubChem (CID 67228331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).