C40H39Cl2N5O6S — CID 67228354
N-(4-chloro-3-nitrophenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)benzamide (PubChem CID 67228354) has the molecular formula C40H39Cl2N5O6S and a molecular weight of 788.75 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)benzamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)benzamide |
|---|---|
| PubChem CID | 67228354 |
| Molecular Formula | C40H39Cl2N5O6S |
| Molecular Weight | 788.75 g/mol |
| Exact Mass | 787.20 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)sulfonyl-4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-indol-5-yloxy)benzamide |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(Cl)c([N+](=O)[O-])c4)c(Oc4ccc5[nH]ccc5c4)c3)CC2)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C40H39Cl2N5O6S/c1-40(2)15-13-28(34(24-40)26-3-5-29(41)6-4-26)25-45-17-19-46(20-18-45)30-7-10-33(38(22-30)53-31-8-12-36-27(21-31)14-16-43-36)39(48)44-54(51,52)32-9-11-35(42)37(23-32)47(49)50/h3-12,14,16,21-23,43H,13,15,17-20,24-25H2,1-2H3,(H,44,48) |
| InChIKey | SAPLCFAZPDGEJB-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.75 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|