About 1H-indol-2-ylmethyl 2-aminoacetate
1H-indol-2-ylmethyl 2-aminoacetate (PubChem CID 67228624) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1H-indol-2-ylmethyl 2-aminoacetate.
Molecular Properties
| Compound Name | 1H-indol-2-ylmethyl 2-aminoacetate |
| PubChem CID | 67228624 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1H-indol-2-ylmethyl 2-aminoacetate |
| SMILES | NCC(=O)OCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H12N2O2/c12-6-11(14)15-7-9-5-8-3-1-2-4-10(8)13-9/h1-5,13H,6-7,12H2 |
| InChIKey | GYCGTZRJADGQLE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indol-2-ylmethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-2-ylmethyl 2-aminoacetate?
The IUPAC name of 1H-indol-2-ylmethyl 2-aminoacetate (CID 67228624) is 1H-indol-2-ylmethyl 2-aminoacetate.
What is the SMILES notation for 1H-indol-2-ylmethyl 2-aminoacetate?
The canonical SMILES for 1H-indol-2-ylmethyl 2-aminoacetate is NCC(=O)OCc1cc2ccccc2[nH]1.
What is the InChIKey of 1H-indol-2-ylmethyl 2-aminoacetate?
The InChIKey is GYCGTZRJADGQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c12-6-11(14)15-7-9-5-8-3-1-2-4-10(8)13-9/h1-5,13H,6-7,12H2.
What are the key properties of 1H-indol-2-ylmethyl 2-aminoacetate?
1H-indol-2-ylmethyl 2-aminoacetate has a molecular weight of 204.23 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-2-ylmethyl 2-aminoacetate is sourced from PubChem (CID 67228624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).