About 5-methyl-1,4-dipentyltriazole
5-methyl-1,4-dipentyltriazole (PubChem CID 67229294) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 5-methyl-1,4-dipentyltriazole.
Molecular Properties
| Compound Name | 5-methyl-1,4-dipentyltriazole |
| PubChem CID | 67229294 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 5-methyl-1,4-dipentyltriazole |
| SMILES | CCCCCc1nnn(CCCCC)c1C |
| InChI | InChI=1S/C13H25N3/c1-4-6-8-10-13-12(3)16(15-14-13)11-9-7-5-2/h4-11H2,1-3H3 |
| InChIKey | ZNPDPHFRYDMWLO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1,4-dipentyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,4-dipentyltriazole?
The IUPAC name of 5-methyl-1,4-dipentyltriazole (CID 67229294) is 5-methyl-1,4-dipentyltriazole.
What is the SMILES notation for 5-methyl-1,4-dipentyltriazole?
The canonical SMILES for 5-methyl-1,4-dipentyltriazole is CCCCCc1nnn(CCCCC)c1C.
What is the InChIKey of 5-methyl-1,4-dipentyltriazole?
The InChIKey is ZNPDPHFRYDMWLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3/c1-4-6-8-10-13-12(3)16(15-14-13)11-9-7-5-2/h4-11H2,1-3H3.
What are the key properties of 5-methyl-1,4-dipentyltriazole?
5-methyl-1,4-dipentyltriazole has a molecular weight of 223.36 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,4-dipentyltriazole is sourced from PubChem (CID 67229294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).