About 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid
2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid (PubChem CID 67229775) has the molecular formula C17H15F2N3O3
and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
| PubChem CID | 67229775 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
| SMILES | COCCn1c(Nc2c(F)cccc2F)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C17H15F2N3O3/c1-25-8-7-22-14-6-5-10(16(23)24)9-13(14)20-17(22)21-15-11(18)3-2-4-12(15)19/h2-6,9H,7-8H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | XXHLIQXFYPGPJM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
The IUPAC name of 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid (CID 67229775) is 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
The canonical SMILES for 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid is COCCn1c(Nc2c(F)cccc2F)nc2cc(C(=O)O)ccc21.
What is the InChIKey of 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
The InChIKey is XXHLIQXFYPGPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O3/c1-25-8-7-22-14-6-5-10(16(23)24)9-13(14)20-17(22)21-15-11(18)3-2-4-12(15)19/h2-6,9H,7-8H2,1H3,(H,20,21)(H,23,24).
What are the key properties of 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid has a molecular weight of 347.32 g/mol, XLogP of 3.40, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluoroanilino)-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid is sourced from PubChem (CID 67229775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).