C28H29N3O3 — CID 67229818
2-[2-[2-[2-(diethylamino)ethoxy]-3-hydroxyphenyl]ethenyl]-3-phenylquinazolin-4-one (PubChem CID 67229818) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[2-[2-[2-(diethylamino)ethoxy]-3-hydroxyphenyl]ethenyl]-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-[2-[2-(diethylamino)ethoxy]-3-hydroxyphenyl]ethenyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 67229818 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[2-[2-[2-(diethylamino)ethoxy]-3-hydroxyphenyl]ethenyl]-3-phenylquinazolin-4-one |
| SMILES | CCN(CC)CCOc1c(O)cccc1C=Cc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H29N3O3/c1-3-30(4-2)19-20-34-27-21(11-10-16-25(27)32)17-18-26-29-24-15-9-8-14-23(24)28(33)31(26)22-12-6-5-7-13-22/h5-18,32H,3-4,19-20H2,1-2H3 |
| InChIKey | BLBVYPXNYCQKNC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |