C16H33N3O2Si — CID 67229919
1-[(9aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]ethanone (PubChem CID 67229919) has the molecular formula C16H33N3O2Si and a molecular weight of 327.55 g/mol. Its IUPAC name is 1-[(9aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]ethanone.
| Compound Name | 1-[(9aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 67229919 |
| Molecular Formula | C16H33N3O2Si |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 1-[(9aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]ethanone |
| SMILES | CC(=O)N1CCN2CC(CO[Si](C)(C)C(C)(C)C)NC[C@H]2C1 |
| InChI | InChI=1S/C16H33N3O2Si/c1-13(20)18-7-8-19-10-14(17-9-15(19)11-18)12-21-22(5,6)16(2,3)4/h14-15,17H,7-12H2,1-6H3/t14?,15-/m0/s1 |
| InChIKey | BSBHJJOSYCWCIO-LOACHALJSA-N |
| XLogP | 1.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|