C19H28ClN3O2 — CID 67230047
7-[1-(2-chlorophenyl)ethoxy]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol (PubChem CID 67230047) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 7-[1-(2-chlorophenyl)ethoxy]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol.
| Compound Name | 7-[1-(2-chlorophenyl)ethoxy]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol |
|---|---|
| PubChem CID | 67230047 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 7-[1-(2-chlorophenyl)ethoxy]-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol |
| SMILES | CC(OCCCC(C(O)C(C)(C)C)n1cncn1)c1ccccc1Cl |
| InChI | InChI=1S/C19H28ClN3O2/c1-14(15-8-5-6-9-16(15)20)25-11-7-10-17(18(24)19(2,3)4)23-13-21-12-22-23/h5-6,8-9,12-14,17-18,24H,7,10-11H2,1-4H3 |
| InChIKey | MICWAACXDPVNLD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|