About 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid
1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid (PubChem CID 67230440) has the molecular formula C8H10F2O4
and a molecular weight of 208.16 g/mol. Its IUPAC name is 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid |
| PubChem CID | 67230440 |
| Molecular Formula | C8H10F2O4 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid |
| SMILES | CCOC(=O)C1(C(=O)O)CC(F)(F)C1 |
| InChI | InChI=1S/C8H10F2O4/c1-2-14-6(13)7(5(11)12)3-8(9,10)4-7/h2-4H2,1H3,(H,11,12) |
| InChIKey | XVFDTXYSPJXFLD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid?
The IUPAC name of 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid (CID 67230440) is 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid?
The canonical SMILES for 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid is CCOC(=O)C1(C(=O)O)CC(F)(F)C1.
What is the InChIKey of 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid?
The InChIKey is XVFDTXYSPJXFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O4/c1-2-14-6(13)7(5(11)12)3-8(9,10)4-7/h2-4H2,1H3,(H,11,12).
What are the key properties of 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid?
1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid has a molecular weight of 208.16 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxycarbonyl-3,3-difluorocyclobutane-1-carboxylic acid is sourced from PubChem (CID 67230440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).