About bis(7H-purine);pyrimidine
bis(7H-purine);pyrimidine (PubChem CID 67230522) has the molecular formula C14H12N10
and a molecular weight of 320.32 g/mol. Its IUPAC name is bis(7H-purine);pyrimidine.
Molecular Properties
| Compound Name | bis(7H-purine);pyrimidine |
| PubChem CID | 67230522 |
| Molecular Formula | C14H12N10 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | bis(7H-purine);pyrimidine |
| SMILES | c1cncnc1.c1ncc2[nH]cnc2n1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/2C5H4N4.C4H4N2/c2*1-4-5(8-2-6-1)9-3-7-4;1-2-5-4-6-3-1/h2*1-3H,(H,6,7,8,9);1-4H |
| InChIKey | VCPXMKYSHVGGJL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(7H-purine);pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(7H-purine);pyrimidine?
The IUPAC name of bis(7H-purine);pyrimidine (CID 67230522) is bis(7H-purine);pyrimidine.
What is the SMILES notation for bis(7H-purine);pyrimidine?
The canonical SMILES for bis(7H-purine);pyrimidine is c1cncnc1.c1ncc2[nH]cnc2n1.c1ncc2[nH]cnc2n1.
What is the InChIKey of bis(7H-purine);pyrimidine?
The InChIKey is VCPXMKYSHVGGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H4N4.C4H4N2/c2*1-4-5(8-2-6-1)9-3-7-4;1-2-5-4-6-3-1/h2*1-3H,(H,6,7,8,9);1-4H.
What are the key properties of bis(7H-purine);pyrimidine?
bis(7H-purine);pyrimidine has a molecular weight of 320.32 g/mol, XLogP of 1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(7H-purine);pyrimidine is sourced from PubChem (CID 67230522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).