About methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate
methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate (PubChem CID 67230961) has the molecular formula C16H16ClN3O5
and a molecular weight of 365.77 g/mol. Its IUPAC name is methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate |
| PubChem CID | 67230961 |
| Molecular Formula | C16H16ClN3O5 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate |
| SMILES | COC(=O)CC(=O)C(Nn1cc(Cl)cc1C(=O)OC)c1cccnc1 |
| InChI | InChI=1S/C16H16ClN3O5/c1-24-14(22)7-13(21)15(10-4-3-5-18-8-10)19-20-9-11(17)6-12(20)16(23)25-2/h3-6,8-9,15,19H,7H2,1-2H3 |
| InChIKey | STVXXCLRFJZLCF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate?
The IUPAC name of methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate (CID 67230961) is methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate?
The canonical SMILES for methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate is COC(=O)CC(=O)C(Nn1cc(Cl)cc1C(=O)OC)c1cccnc1.
What is the InChIKey of methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate?
The InChIKey is STVXXCLRFJZLCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O5/c1-24-14(22)7-13(21)15(10-4-3-5-18-8-10)19-20-9-11(17)6-12(20)16(23)25-2/h3-6,8-9,15,19H,7H2,1-2H3.
What are the key properties of methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate?
methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate has a molecular weight of 365.77 g/mol, XLogP of 1.74, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-1-[(4-methoxy-2,4-dioxo-1-pyridin-3-ylbutyl)amino]pyrrole-2-carboxylate is sourced from PubChem (CID 67230961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).