About methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate
methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 67231646) has the molecular formula C13H15F2NO4S
and a molecular weight of 319.33 g/mol. Its IUPAC name is methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| PubChem CID | 67231646 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(F)(F)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15F2NO4S/c1-9-3-5-10(6-4-9)21(18,19)16-8-13(14,15)7-11(16)12(17)20-2/h3-6,11H,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | DQLLHUQFNKMVGV-NSHDSACASA-N |
| XLogP | 1.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
The IUPAC name of methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (CID 67231646) is methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate is COC(=O)[C@@H]1CC(F)(F)CN1S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
The InChIKey is DQLLHUQFNKMVGV-NSHDSACASA-N. The full InChI is InChI=1S/C13H15F2NO4S/c1-9-3-5-10(6-4-9)21(18,19)16-8-13(14,15)7-11(16)12(17)20-2/h3-6,11H,7-8H2,1-2H3/t11-/m0/s1.
What are the key properties of methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate?
methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate has a molecular weight of 319.33 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-4,4-difluoro-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate is sourced from PubChem (CID 67231646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).