C23H35N5O3 — CID 67231939
2-[1-[5-(cyclohexylcarbamoyl)-6-piperazin-1-yl-2-pyridinyl]piperidin-3-yl]acetic acid (PubChem CID 67231939) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[1-[5-(cyclohexylcarbamoyl)-6-piperazin-1-yl-2-pyridinyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[5-(cyclohexylcarbamoyl)-6-piperazin-1-yl-2-pyridinyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 67231939 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-[1-[5-(cyclohexylcarbamoyl)-6-piperazin-1-yl-2-pyridinyl]piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(c2ccc(C(=O)NC3CCCCC3)c(N3CCNCC3)n2)C1 |
| InChI | InChI=1S/C23H35N5O3/c29-21(30)15-17-5-4-12-28(16-17)20-9-8-19(22(26-20)27-13-10-24-11-14-27)23(31)25-18-6-2-1-3-7-18/h8-9,17-18,24H,1-7,10-16H2,(H,25,31)(H,29,30) |
| InChIKey | ZRWLIWLEJVTMNH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |