C18H14Cl3N7O3 — CID 67231944
2-[3-[3-[1-[(3,4,5-trichlorophenyl)methyl]triazol-4-yl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]butanoic acid (PubChem CID 67231944) has the molecular formula C18H14Cl3N7O3 and a molecular weight of 482.72 g/mol. Its IUPAC name is 2-[3-[3-[1-[(3,4,5-trichlorophenyl)methyl]triazol-4-yl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]butanoic acid.
| Compound Name | 2-[3-[3-[1-[(3,4,5-trichlorophenyl)methyl]triazol-4-yl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 67231944 |
| Molecular Formula | C18H14Cl3N7O3 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 2-[3-[3-[1-[(3,4,5-trichlorophenyl)methyl]triazol-4-yl]-1,2,4-oxadiazol-5-yl]pyrazol-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)n1ccc(-c2nc(-c3cn(Cc4cc(Cl)c(Cl)c(Cl)c4)nn3)no2)n1 |
| InChI | InChI=1S/C18H14Cl3N7O3/c1-2-14(18(29)30)28-4-3-12(24-28)17-22-16(25-31-17)13-8-27(26-23-13)7-9-5-10(19)15(21)11(20)6-9/h3-6,8,14H,2,7H2,1H3,(H,29,30) |
| InChIKey | XSEAEFIFOCGAQJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|