C19H20ClFN6O2 — CID 67232281
[4-amino-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl] N-[(4-chloro-2-fluorophenyl)methyl]carbamate (PubChem CID 67232281) has the molecular formula C19H20ClFN6O2 and a molecular weight of 418.86 g/mol. Its IUPAC name is [4-amino-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl] N-[(4-chloro-2-fluorophenyl)methyl]carbamate.
| Compound Name | [4-amino-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl] N-[(4-chloro-2-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 67232281 |
| Molecular Formula | C19H20ClFN6O2 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [4-amino-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-4-yl] N-[(4-chloro-2-fluorophenyl)methyl]carbamate |
| SMILES | NC1(OC(=O)NCc2ccc(Cl)cc2F)CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C19H20ClFN6O2/c20-13-2-1-12(15(21)9-13)10-24-18(28)29-19(22)4-7-27(8-5-19)17-14-3-6-23-16(14)25-11-26-17/h1-3,6,9,11H,4-5,7-8,10,22H2,(H,24,28)(H,23,25,26) |
| InChIKey | AICCUITVNLHTDR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|