C19H19Cl2NO2 — CID 67232869
(3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-2-methylpyrrolidine-3-carboxylic acid (PubChem CID 67232869) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-2-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-2-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67232869 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (3R,4S)-1-benzyl-4-(3,4-dichlorophenyl)-2-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1[C@H](C(=O)O)[C@@H](c2ccc(Cl)c(Cl)c2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H19Cl2NO2/c1-12-18(19(23)24)15(14-7-8-16(20)17(21)9-14)11-22(12)10-13-5-3-2-4-6-13/h2-9,12,15,18H,10-11H2,1H3,(H,23,24)/t12?,15-,18+/m1/s1 |
| InChIKey | HHFIYTPYEBPNFS-PORJIIPISA-N |
| XLogP | 4.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |