About 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene
1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene (PubChem CID 67232908) has the molecular formula C25H23ClO
and a molecular weight of 374.91 g/mol. Its IUPAC name is 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene.
Molecular Properties
| Compound Name | 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene |
| PubChem CID | 67232908 |
| Molecular Formula | C25H23ClO |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene |
| SMILES | C1=Cc2ccccc2C1.C=Cc1ccc(Cl)cc1.C=Cc1ccccc1O |
| InChI | InChI=1S/C9H8.C8H7Cl.C8H8O/c1-2-5-9-7-3-6-8(9)4-1;1-2-7-3-5-8(9)6-4-7;1-2-7-5-3-4-6-8(7)9/h1-6H,7H2;2-6H,1H2;2-6,9H,1H2 |
| InChIKey | UQNUMXUNRHHKTN-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene?
The IUPAC name of 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene (CID 67232908) is 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene.
What is the SMILES notation for 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene?
The canonical SMILES for 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene is C1=Cc2ccccc2C1.C=Cc1ccc(Cl)cc1.C=Cc1ccccc1O.
What is the InChIKey of 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene?
The InChIKey is UQNUMXUNRHHKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C8H7Cl.C8H8O/c1-2-5-9-7-3-6-8(9)4-1;1-2-7-3-5-8(9)6-4-7;1-2-7-5-3-4-6-8(7)9/h1-6H,7H2;2-6H,1H2;2-6,9H,1H2.
What are the key properties of 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene?
1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene has a molecular weight of 374.91 g/mol, XLogP of 7.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-ethenylbenzene;2-ethenylphenol;1H-indene is sourced from PubChem (CID 67232908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).