C10H10BrNO4S — CID 67232936
ethyl 2-(2-bromo-4,6-dioxo-3a,6a-dihydrothieno[2,3-c]pyrrol-5-yl)acetate (PubChem CID 67232936) has the molecular formula C10H10BrNO4S and a molecular weight of 320.16 g/mol. Its IUPAC name is ethyl 2-(2-bromo-4,6-dioxo-3a,6a-dihydrothieno[2,3-c]pyrrol-5-yl)acetate.
| Compound Name | ethyl 2-(2-bromo-4,6-dioxo-3a,6a-dihydrothieno[2,3-c]pyrrol-5-yl)acetate |
|---|---|
| PubChem CID | 67232936 |
| Molecular Formula | C10H10BrNO4S |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | ethyl 2-(2-bromo-4,6-dioxo-3a,6a-dihydrothieno[2,3-c]pyrrol-5-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C=C(Br)SC2C1=O |
| InChI | InChI=1S/C10H10BrNO4S/c1-2-16-7(13)4-12-9(14)5-3-6(11)17-8(5)10(12)15/h3,5,8H,2,4H2,1H3 |
| InChIKey | BEPDBEQPOPWZDX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|