C16H18FNO7S — CID 67233052
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(6-fluoro-3-pyridinyl)sulfanyl]oxan-3-yl] acetate (PubChem CID 67233052) has the molecular formula C16H18FNO7S and a molecular weight of 387.39 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(6-fluoro-3-pyridinyl)sulfanyl]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(6-fluoro-3-pyridinyl)sulfanyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 67233052 |
| Molecular Formula | C16H18FNO7S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-[(6-fluoro-3-pyridinyl)sulfanyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2ccc(F)nc2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H18FNO7S/c1-8(19)23-12-7-22-16(26-11-4-5-13(17)18-6-11)15(25-10(3)21)14(12)24-9(2)20/h4-6,12,14-16H,7H2,1-3H3/t12-,14+,15-,16+/m1/s1 |
| InChIKey | PMJAHGDYOHQSJI-BVUBDWEXSA-N |
| XLogP | 1.46 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|