C11H14FNO4S — CID 67233142
(2R,3R,4S,5S)-2-[(2-fluoro-6-methyl-3-pyridinyl)oxy]thiane-3,4,5-triol (PubChem CID 67233142) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[(2-fluoro-6-methyl-3-pyridinyl)oxy]thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[(2-fluoro-6-methyl-3-pyridinyl)oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67233142 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (2R,3R,4S,5S)-2-[(2-fluoro-6-methyl-3-pyridinyl)oxy]thiane-3,4,5-triol |
| SMILES | Cc1ccc(O[C@@H]2SC[C@@H](O)[C@H](O)[C@H]2O)c(F)n1 |
| InChI | InChI=1S/C11H14FNO4S/c1-5-2-3-7(10(12)13-5)17-11-9(16)8(15)6(14)4-18-11/h2-3,6,8-9,11,14-16H,4H2,1H3/t6-,8+,9-,11-/m1/s1 |
| InChIKey | ZFWYYECOAOWJPV-DYUFWOLASA-N |
| XLogP | 0.06 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|