C51H47N7O3 — CID 67233574
(3R)-3-[[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-4-phenylbutanoic acid (PubChem CID 67233574) has the molecular formula C51H47N7O3 and a molecular weight of 805.98 g/mol. Its IUPAC name is (3R)-3-[[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-4-phenylbutanoic acid.
| Compound Name | (3R)-3-[[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 67233574 |
| Molecular Formula | C51H47N7O3 |
| Molecular Weight | 805.98 g/mol |
| Exact Mass | 805.37 |
| IUPAC Name | (3R)-3-[[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonyl]amino]-4-phenylbutanoic acid |
| SMILES | CCCCc1ncc(C(=O)N[C@@H](CC(=O)O)Cc2ccccc2)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C51H47N7O3/c1-2-3-28-47-52-35-46(50(61)53-43(34-48(59)60)33-37-18-8-4-9-19-37)57(47)36-38-29-31-39(32-30-38)44-26-16-17-27-45(44)49-54-55-56-58(49)51(40-20-10-5-11-21-40,41-22-12-6-13-23-41)42-24-14-7-15-25-42/h4-27,29-32,35,43H,2-3,28,33-34,36H2,1H3,(H,53,61)(H,59,60)/t43-/m1/s1 |
| InChIKey | WQWQIMAJDPDICV-VZUYHUTRSA-N |
| XLogP | 9.25 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.98 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|