C17H19NO4 — CID 67234198
methyl (3R,6S,7aS)-5-oxo-3-phenyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 67234198) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (3R,6S,7aS)-5-oxo-3-phenyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (3R,6S,7aS)-5-oxo-3-phenyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 67234198 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (3R,6S,7aS)-5-oxo-3-phenyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)C[C@H]2CO[C@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C17H19NO4/c1-3-9-17(16(20)21-2)10-13-11-22-14(18(13)15(17)19)12-7-5-4-6-8-12/h3-8,13-14H,1,9-11H2,2H3/t13-,14+,17-/m0/s1 |
| InChIKey | IMCNKPLULUTNQC-VBQJREDUSA-N |
| XLogP | 2.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|