C31H32N2O4 — CID 67234593
[5-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-2-oxo-1H-quinolin-8-yl] benzoate (PubChem CID 67234593) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is [5-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-2-oxo-1H-quinolin-8-yl] benzoate.
| Compound Name | [5-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-2-oxo-1H-quinolin-8-yl] benzoate |
|---|---|
| PubChem CID | 67234593 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | [5-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-2-oxo-1H-quinolin-8-yl] benzoate |
| SMILES | CCc1cc2c(cc1CC)CC(NC[C@H](O)c1ccc(OC(=O)c3ccccc3)c3[nH]c(=O)ccc13)C2 |
| InChI | InChI=1S/C31H32N2O4/c1-3-19-14-22-16-24(17-23(22)15-20(19)4-2)32-18-27(34)25-10-12-28(30-26(25)11-13-29(35)33-30)37-31(36)21-8-6-5-7-9-21/h5-15,24,27,32,34H,3-4,16-18H2,1-2H3,(H,33,35)/t27-/m0/s1 |
| InChIKey | BDUROTIJFPAKEH-MHZLTWQESA-N |
| XLogP | 4.66 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|