About (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine
(4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine (PubChem CID 67234934) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine.
Molecular Properties
| Compound Name | (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine |
| PubChem CID | 67234934 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine |
| SMILES | N[C@H]1CCc2ccccc2-n2ccnc21 |
| InChI | InChI=1S/C12H13N3/c13-10-6-5-9-3-1-2-4-11(9)15-8-7-14-12(10)15/h1-4,7-8,10H,5-6,13H2/t10-/m0/s1 |
| InChIKey | UMFYXYABQLRNNV-JTQLQIEISA-N |
| XLogP | 1.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine?
The IUPAC name of (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine (CID 67234934) is (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine.
What is the SMILES notation for (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine?
The canonical SMILES for (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine is N[C@H]1CCc2ccccc2-n2ccnc21.
What is the InChIKey of (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine?
The InChIKey is UMFYXYABQLRNNV-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13N3/c13-10-6-5-9-3-1-2-4-11(9)15-8-7-14-12(10)15/h1-4,7-8,10H,5-6,13H2/t10-/m0/s1.
What are the key properties of (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine?
(4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine has a molecular weight of 199.26 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-amine is sourced from PubChem (CID 67234934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).