About (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide
(2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide (PubChem CID 67235320) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide.
Molecular Properties
| Compound Name | (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide |
| PubChem CID | 67235320 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide |
| SMILES | Cc1cccc(C)c1Oc1ccc(N[C@H](C)C(N)=O)cn1 |
| InChI | InChI=1S/C16H19N3O2/c1-10-5-4-6-11(2)15(10)21-14-8-7-13(9-18-14)19-12(3)16(17)20/h4-9,12,19H,1-3H3,(H2,17,20)/t12-/m1/s1 |
| InChIKey | BKGPOILEMYEOQR-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide?
The IUPAC name of (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide (CID 67235320) is (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide.
What is the SMILES notation for (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide?
The canonical SMILES for (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide is Cc1cccc(C)c1Oc1ccc(N[C@H](C)C(N)=O)cn1.
What is the InChIKey of (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide?
The InChIKey is BKGPOILEMYEOQR-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H19N3O2/c1-10-5-4-6-11(2)15(10)21-14-8-7-13(9-18-14)19-12(3)16(17)20/h4-9,12,19H,1-3H3,(H2,17,20)/t12-/m1/s1.
What are the key properties of (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide?
(2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide has a molecular weight of 285.35 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[6-(2,6-dimethylphenoxy)-3-pyridinyl]amino]propanamide is sourced from PubChem (CID 67235320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).