About (7aS)-1,7a-dihydrobenzimidazol-2-one
(7aS)-1,7a-dihydrobenzimidazol-2-one (PubChem CID 67235393) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is (7aS)-1,7a-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | (7aS)-1,7a-dihydrobenzimidazol-2-one |
| PubChem CID | 67235393 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | (7aS)-1,7a-dihydrobenzimidazol-2-one |
| SMILES | O=C1N=C2C=CC=C[C@@H]2N1 |
| InChI | InChI=1S/C7H6N2O/c10-7-8-5-3-1-2-4-6(5)9-7/h1-5H,(H,8,10)/t5-/m0/s1 |
| InChIKey | USKOHSXXLFBRFC-YFKPBYRVSA-N |
| XLogP | 0.65 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (7aS)-1,7a-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aS)-1,7a-dihydrobenzimidazol-2-one?
The IUPAC name of (7aS)-1,7a-dihydrobenzimidazol-2-one (CID 67235393) is (7aS)-1,7a-dihydrobenzimidazol-2-one.
What is the SMILES notation for (7aS)-1,7a-dihydrobenzimidazol-2-one?
The canonical SMILES for (7aS)-1,7a-dihydrobenzimidazol-2-one is O=C1N=C2C=CC=C[C@@H]2N1.
What is the InChIKey of (7aS)-1,7a-dihydrobenzimidazol-2-one?
The InChIKey is USKOHSXXLFBRFC-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H6N2O/c10-7-8-5-3-1-2-4-6(5)9-7/h1-5H,(H,8,10)/t5-/m0/s1.
What are the key properties of (7aS)-1,7a-dihydrobenzimidazol-2-one?
(7aS)-1,7a-dihydrobenzimidazol-2-one has a molecular weight of 134.14 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7aS)-1,7a-dihydrobenzimidazol-2-one is sourced from PubChem (CID 67235393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).