About 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole
6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole (PubChem CID 67235616) has the molecular formula C23H25N5O
and a molecular weight of 387.49 g/mol. Its IUPAC name is 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole |
| PubChem CID | 67235616 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3cnc(-c4cccnc4)cc3c2c1N1CCCN(C)CC1 |
| InChI | InChI=1S/C23H25N5O/c1-27-9-4-10-28(12-11-27)23-21(29-2)7-6-18-22(23)17-13-19(25-15-20(17)26-18)16-5-3-8-24-14-16/h3,5-8,13-15,26H,4,9-12H2,1-2H3 |
| InChIKey | OFNIWTFTULWMFD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole?
The IUPAC name of 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole (CID 67235616) is 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole?
The canonical SMILES for 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole is COc1ccc2[nH]c3cnc(-c4cccnc4)cc3c2c1N1CCCN(C)CC1.
What is the InChIKey of 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole?
The InChIKey is OFNIWTFTULWMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O/c1-27-9-4-10-28(12-11-27)23-21(29-2)7-6-18-22(23)17-13-19(25-15-20(17)26-18)16-5-3-8-24-14-16/h3,5-8,13-15,26H,4,9-12H2,1-2H3.
What are the key properties of 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole?
6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole has a molecular weight of 387.49 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-5-(4-methyl-1,4-diazepan-1-yl)-3-pyridin-3-yl-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 67235616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).