About 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol
3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol (PubChem CID 67235847) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol |
| PubChem CID | 67235847 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol |
| SMILES | C=CCOCC=C.CCCC1CCC(O)CC1 |
| InChI | InChI=1S/C9H18O.C6H10O/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7-6-4-2/h8-10H,2-7H2,1H3;3-4H,1-2,5-6H2 |
| InChIKey | HQWZDFRRHYERFJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol?
The IUPAC name of 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol (CID 67235847) is 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol.
What is the SMILES notation for 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol?
The canonical SMILES for 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol is C=CCOCC=C.CCCC1CCC(O)CC1.
What is the InChIKey of 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol?
The InChIKey is HQWZDFRRHYERFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C6H10O/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7-6-4-2/h8-10H,2-7H2,1H3;3-4H,1-2,5-6H2.
What are the key properties of 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol?
3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol has a molecular weight of 240.39 g/mol, XLogP of 3.71, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoxyprop-1-ene;4-propylcyclohexan-1-ol is sourced from PubChem (CID 67235847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).