About Imidazobenzazepine
Imidazobenzazepine (PubChem CID 67235958) has the molecular formula C11H7N3
and a molecular weight of 181.19 g/mol. Its IUPAC name is imidazo[4,5-i][1]benzazepine.
Molecular Properties
| Compound Name | Imidazobenzazepine |
| PubChem CID | 67235958 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | imidazo[4,5-i][1]benzazepine |
| SMILES | C1=CC=NC2=C3C(=NC=N3)C=CC2=C1 |
| InChI | InChI=1S/C11H7N3/c1-2-6-12-10-8(3-1)4-5-9-11(10)14-7-13-9/h1-7H |
| InChIKey | XKZRHJPCEMWNIX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 497 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Imidazobenzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Imidazobenzazepine?
The IUPAC name of Imidazobenzazepine (CID 67235958) is imidazo[4,5-i][1]benzazepine.
What is the SMILES notation for Imidazobenzazepine?
The canonical SMILES for Imidazobenzazepine is C1=CC=NC2=C3C(=NC=N3)C=CC2=C1.
What is the InChIKey of Imidazobenzazepine?
The InChIKey is XKZRHJPCEMWNIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3/c1-2-6-12-10-8(3-1)4-5-9-11(10)14-7-13-9/h1-7H.
What are the key properties of Imidazobenzazepine?
Imidazobenzazepine has a molecular weight of 181.19 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Imidazobenzazepine is sourced from PubChem (CID 67235958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).