C24H25ClN4O4 — CID 67236113
methyl 5-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]pentanoate (PubChem CID 67236113) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is methyl 5-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]pentanoate.
| Compound Name | methyl 5-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 67236113 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | methyl 5-[4-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]indazol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCn1ncc2c(-c3noc(-c4ccc(OC(C)C)c(Cl)c4)n3)cccc21 |
| InChI | InChI=1S/C24H25ClN4O4/c1-15(2)32-21-11-10-16(13-19(21)25)24-27-23(28-33-24)17-7-6-8-20-18(17)14-26-29(20)12-5-4-9-22(30)31-3/h6-8,10-11,13-15H,4-5,9,12H2,1-3H3 |
| InChIKey | VHOPTGQFELATKY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 92.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|