C36H46B2FNO6 — CID 67236526
(2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (PubChem CID 67236526) has the molecular formula C36H46B2FNO6 and a molecular weight of 629.39 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine.
| Compound Name | (2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 67236526 |
| Molecular Formula | C36H46B2FNO6 |
| Molecular Weight | 629.39 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | (2S,3R,4R,5S)-1-(4-fluorophenyl)-3,4-dimethoxy-2,5-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| SMILES | CO[C@H]1[C@H](OC)[C@H](c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)N(c2ccc(F)cc2)[C@H]1c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C36H46B2FNO6/c1-33(2)34(3,4)44-37(43-33)25-15-11-23(12-16-25)29-31(41-9)32(42-10)30(40(29)28-21-19-27(39)20-22-28)24-13-17-26(18-14-24)38-45-35(5,6)36(7,8)46-38/h11-22,29-32H,1-10H3/t29-,30-,31+,32+/m0/s1 |
| InChIKey | WBOSHDFWNFUEEK-GASGPIRDSA-N |
| XLogP | 5.76 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.39 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|